![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
.jpg){kind=link}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Faizan Record/ | 2024-07-29 10:07 | - | |
| News Paper Cuttings/ | 2024-07-29 10:07 | - | |
| Politics and Religio..> | 2019-05-15 01:35 | 25K | |
| Opportunity Decision..> | 2014-04-15 23:00 | 27K | |
| Controlling Cough.jpg | 2018-04-14 17:52 | 28K | |
| Job Completion Time.jpg | 2020-06-10 13:52 | 30K | |
| Love is Caring.jpeg | 2015-06-21 05:10 | 31K | |
| How to measure succe..> | 2023-02-07 19:28 | 32K | |
| Treatment to Employe..> | 2014-06-24 15:20 | 33K | |
| Germs ka Khof.jpeg | 2014-05-18 01:27 | 34K | |
| English Confusions.jpeg | 2014-05-15 14:18 | 35K | |
| Rumi Quote.jpg | 2023-02-07 16:40 | 35K | |
| Boss vs Leader.jpeg | 2015-05-24 15:28 | 37K | |
| Bechara Mard.jpeg | 2014-07-23 20:02 | 37K | |
| Eye Pictures.jpg | 2020-02-28 20:09 | 37K | |
| Pesticides.jpg | 2020-05-14 20:12 | 38K | |
| Reason of Success.jpeg | 2015-02-21 20:06 | 38K | |
| Trust.jpeg | 2015-01-30 09:17 | 39K | |
| Naak kay Ghudood.jpg | 2023-02-07 19:28 | 39K | |
| Ethics of Life.jpeg | 2014-09-17 18:37 | 39K | |
| Generation Gap.jpeg | 2014-04-06 21:09 | 40K | |
| Centre of Quran.jpg | 2023-02-07 19:28 | 43K | |
| Surah Hujrat Finding..> | 2023-02-07 19:28 | 44K | |
| Depression and Anxie..> | 2014-10-31 07:29 | 45K | |
| Wisdom Quote 1.jpeg | 2014-05-25 06:44 | 45K | |
| Best Employee vs man..> | 2016-08-27 14:33 | 46K | |
| Nakaam Log.jpg | 2023-02-07 19:27 | 47K | |
| Gitray Balo ka Ilaj.jpg | 2023-03-02 19:11 | 47K | |
| Maafi.jpg | 2023-02-07 19:27 | 48K | |
| Gratitude.jpg | 2018-02-23 15:38 | 50K | |
| Sunnah of Nail Cutti..> | 2015-07-11 10:08 | 51K | |
| Zaitoon Kay Faiday.jpg | 2023-02-07 19:27 | 54K | |
| Live Beleif Inspire.jpg | 2018-11-16 10:06 | 56K | |
| Invention of Numbers..> | 2015-02-17 23:26 | 57K | |
| Jo day gaey.jpg | 2023-02-22 13:56 | 57K | |
| Desparate Feeling.jpg | 2016-06-04 08:49 | 66K | |
| Jhagra Quote.jpg | 2023-02-07 19:27 | 66K | |
| Boiled Egg Timing.jpg | 2018-06-26 12:19 | 68K | |
| Nana Tai Card.jpg | 2014-04-22 11:42 | 70K | |
| Difference of Same N..> | 2018-02-23 15:38 | 71K | |
| Haniya First Roza In..> | 2024-03-19 09:30 | 73K | |
| Pakistan National Th..> | 2013-11-30 14:32 | 74K | |
| National Anthem.jpg | 2020-02-28 20:10 | 76K | |
| Information on Learn..> | 2019-07-08 21:01 | 76K | |
| Important msg forwar..> | 2019-02-07 14:23 | 78K | |
| Female Dictionary.jpeg | 2014-05-30 07:05 | 80K | |
| ID NIC Mansoor 2017-..> | 2019-06-10 11:11 | 83K | |
| Askari Bank Account ..> | 2023-02-07 19:27 | 85K | |
| Management Tips.jpeg | 2014-06-19 07:31 | 87K | |
| Leave office on time..> | 2014-06-07 23:44 | 87K | |
| Jupiter.jpg | 2023-02-07 19:26 | 87K | |
| Saira ID Card New cr..> | 2022-02-24 21:29 | 91K | |
| Visiting Card Mansoo..> | 2018-05-01 02:17 | 92K | |
| Madina Dates Prices ..> | 2023-02-07 19:26 | 92K | |
| ID NIC Mansoor Cross..> | 2020-06-10 14:50 | 93K | |
| Remove Permanent Mar..> | 2015-03-14 07:08 | 97K | |
| Namaz ka tareeqa.jpg | 2022-11-17 21:19 | 100K | |
| Namaz Chart.jpg | 2018-11-14 14:22 | 100K | |
| Multicolor Left and ..> | 2020-02-28 20:10 | 103K | |
| Samsung TV Setting.jpg | 2023-02-07 19:26 | 105K | |
| SECP Code.jpg | 2018-09-11 09:33 | 107K | |
| Old Pak Currency.jpg | 2015-06-12 15:45 | 109K | |
| Mansoor Gazette Noti..> | 2021-05-07 12:35 | 117K | |
| Jadoo ki Haqeeqat.jpeg | 2014-05-17 09:39 | 131K | |
| ID Card Shamim.jpg | 2020-06-09 11:54 | 136K | |
| Heat Index Chart.jpg | 2018-11-14 14:22 | 142K | |
| Working Conditions.jpeg | 2015-02-25 05:50 | 152K | |
| Difference of Opinio..> | 2020-05-14 20:12 | 152K | |
| Madina Dates Prices ..> | 2022-03-11 21:12 | 167K | |
| Hard Times to Weak T..> | 2018-01-11 10:14 | 171K | |
| Mansoor 2019.jpg | 2020-05-14 20:12 | 175K | |
| Democracy.jpg | 2020-01-13 16:23 | 179K | |
| Rumors.jpg | 2020-01-20 10:37 | 185K | |
| TCL TV Secret Code.jpg | 2023-10-14 20:23 | 191K | |
| Record of Cross Word..> | 2016-12-30 22:46 | 193K | |
| CEO KTDMC Ad 2024.jpg | 2024-07-07 11:14 | 220K | |
| Kuch to log kahain g..> | 2020-05-14 20:12 | 239K | |
| Ad CEO 2020 KTDMC.jpg | 2020-09-14 11:25 | 271K | |
| Anjuman Asfia Accoun..> | 2020-03-29 22:43 | 273K | |
| Nadra family verific..> | 2018-09-11 09:34 | 293K | |
| Art of Giving.jpg | 2018-01-22 14:21 | 302K | |
| Ayat on Qarz.png | 2016-11-23 21:33 | 367K | |
| Information of Fire ..> | 2020-06-10 14:50 | 382K | |
| Changhong Remote Uni..> | 2022-12-17 21:39 | 388K | |
| Screenshot_20220207-..> | 2022-02-07 11:02 | 393K | |
| Mansoor 2019(2).jpg | 2020-05-14 20:12 | 396K | |
| Madina Date Rates 20..> | 2019-04-16 14:43 | 424K | |
| Reality of Life.jpg | 2019-07-29 00:20 | 435K | |
| Halal by Quran.jpg | 2020-05-14 20:12 | 470K | |
| 2024-01-15 16.53.37-..> | 2024-01-15 16:53 | 546K | |
| Remaining Namaz Proc..> | 2017-01-23 00:22 | 547K | |
| PAF Ranks.png | 2017-11-29 10:09 | 561K | |
| Training of Mind to ..> | 2019-06-02 23:24 | 586K | |
| CEO KTDMC BPS.jpg | 2021-09-21 19:11 | 591K | |
| Dragon Pass Card.jpg | 2023-02-07 19:24 | 627K | |
| Madina Dates 2024.jpg | 2024-02-27 12:03 | 640K | |
| Mansoor Covid Certif..> | 2022-09-21 11:41 | 643K | |
| 2024-04-13 11.29.50.jpg | 2024-04-13 11:29 | 839K | |
| Family_Tree_of_Proph..> | 2020-05-14 20:12 | 876K | |
| 2024-04-13 11.29.46.jpg | 2024-04-13 11:29 | 895K | |
| 2024-04-13 11.29.42.jpg | 2024-04-13 11:29 | 905K | |
| Shamim Vaccination C..> | 2021-07-01 15:18 | 934K | |
| Naqi Ullah Vaccinati..> | 2021-07-01 15:18 | 958K | |
| Alia Sharifa Vaccina..> | 2021-07-01 15:18 | 960K | |
| Shamsa Vaccination C..> | 2021-07-01 15:18 | 963K | |
| Dr. Munir Hamirani.jpg | 2020-06-10 14:50 | 1.0M | |
| Saira Vaccination Ce..> | 2021-08-20 19:40 | 1.0M | |
| Quetta Town Plot Det..> | 2023-02-07 19:24 | 1.1M | |
| Quetta Town Plot Det..> | 2023-02-07 19:24 | 1.1M | |
| Shajarah Nadbai.jpg | 2017-10-03 15:55 | 1.1M | |
| Quetta Town Plot Det..> | 2020-11-09 18:52 | 1.2M | |
| Shirts March 2024.jpg | 2024-03-18 09:56 | 1.2M | |
| Shirts Stock 2024.jpg | 2024-03-17 23:06 | 1.2M | |
| Blood Group Card Man..> | 2017-08-23 15:38 | 1.3M | |
| Massager Machine Det..> | 2020-12-09 18:29 | 1.3M | |
| Ad CEO KTDMC.png | 2017-02-09 22:09 | 1.4M | |
| EOBI Card New.jpg | 2022-12-19 11:22 | 1.5M | |
| Agha Khan Card Manso..> | 2017-11-01 16:23 | 1.6M | |
| Final Choice Loyalti..> | 2023-02-07 19:22 | 1.7M | |
| Fake Notes.jpg | 2020-06-10 14:50 | 1.8M | |
| 20201210_080236.jpg | 2020-12-10 08:02 | 1.8M | |
| AUB836 100k Km.jpg | 2014-11-21 07:40 | 1.8M | |
| Agha Khan Card Shams..> | 2016-10-30 23:24 | 2.4M | |
| AUB Remote Controlle..> | 2023-02-07 19:20 | 2.5M | |
| AUB Remote Controlle..> | 2020-06-10 14:50 | 2.5M | |
| Mansoor Sarah Weddin..> | 2022-07-08 22:41 | 2.6M | |
| Samsung Ref Details.jpg | 2018-07-20 20:27 | 2.6M | |
| 20230502_231903.jpg | 2023-05-02 23:19 | 2.6M | |
| EOBI Card Old.jpg | 2023-02-07 16:42 | 2.7M | |
| How to solve a rubik..> | 2022-11-24 09:43 | 3.0M | |
| Dr Jatoi Timings.jpg | 2018-02-27 20:36 | 3.0M | |
| How to solve a rubik..> | 2022-11-24 09:43 | 3.2M | |
| Dr. Munir Hamirani c..> | 2019-01-08 09:09 | 3.2M | |
| How to solve a rubik..> | 2022-11-24 09:43 | 3.3M | |
| Jazz Wingle Details.jpg | 2022-03-22 22:27 | 3.3M | |
| Deposit Box.jpg | 2018-04-13 21:59 | 3.5M | |
| Younus Halal Restaur..> | 2022-10-04 19:25 | 3.5M | |
| Agha Khan Card Saira..> | 2018-06-03 12:10 | 3.8M | |
| 20230402_133653.jpg | 2023-04-02 13:36 | 3.9M | |
| Shirts April 2023.jpg | 2023-04-02 13:36 | 3.9M | |
| ASF Tower Registrati..> | 2018-11-14 14:22 | 4.5M | |
| LG TV Details.jpg | 2022-02-23 16:38 | 5.1M | |
